Jump to content

Antrafenine: Difference between revisions

Page 1
Page 2
Content deleted Content added
CheMoBot (talk | contribs)
Updating {{drugbox}} (changes to verified fields - updated 'KEGG_Ref') per Chem/Drugbox validation (report errors or bugs)
0dorkmann (talk | contribs)
infobox +width = 175px
 
(20 intermediate revisions by 16 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{drugbox
{{Drugbox
| Verifiedfields = changed
| UNII_Ref = {{fdacite|changed|FDA}}
| Watchedfields = changed
| verifiedrevid = 437136259
| IUPAC_name = 2-<nowiki/>{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl 2-<nowiki/>{[7-(trifluoromethyl)quinolin-4-yl]amino}benzoate
| image = Antrafenine.svg
| width = 175px
<!--Clinical data-->
| tradename =
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = [[Mouth|Oral]]
<!--Pharmacokinetic data-->
| bioavailability =
| metabolism = [[Hepatic]]
| elimination_half-life =
| excretion = [[Renal]]
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 55300-29-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 68723
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01419
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 61973
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 21FS93Y6OE
| UNII = 21FS93Y6OE
| verifiedrevid = 413867963
| IUPAC_name = 2-{4-[3-(trifluoromethyl)phenyl]piperazin-1-yl}ethyl 2-{[7-(trifl​uoromethyl)quinolin-4-yl]amino}benzoate
| image = Antrafenine.svg
| CASNo_Ref = {{cascite|correct|CAS}}
| InChI = 1/C30H26F6N4O2/c31-29(32,33)20-4-3-5-22(18-20)40-14-12-39(13-15-40)16-17-42-28(41)24-6-1-2-7-25(24)38-26-10-11-37-27-19-21(30(34,35)36)8-9-23(26)27/h1-11,18-19H,12-17H2,(H,37,38)
| InChIKey = NWGGKKGAFZIVBJ-UHFFFAOYAT
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 345524
| ChEMBL = 345524
<!--Chemical data-->
| C=30 | H=26
| F=6 | N=4
| O=2
| smiles = FC(F)(F)c5ccc1c(nccc1Nc2ccccc2C(=O)OCCN4CCN(c3cc(ccc3)C(F)(F)F)CC4)c5
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C30H26F6N4O2/c31-29(32,33)20-4-3-5-22(18-20)40-14-12-39(13-15-40)16-17-42-28(41)24-6-1-2-7-25(24)38-26-10-11-37-27-19-21(30(34,35)36)8-9-23(26)27/h1-11,18-19H,12-17H2,(H,37,38)
| StdInChI = 1S/C30H26F6N4O2/c31-29(32,33)20-4-3-5-22(18-20)40-14-12-39(13-15-40)16-17-42-28(41)24-6-1-2-7-25(24)38-26-10-11-37-27-19-21(30(34,35)36)8-9-23(26)27/h1-11,18-19H,12-17H2,(H,37,38)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NWGGKKGAFZIVBJ-UHFFFAOYSA-N
| StdInChIKey = NWGGKKGAFZIVBJ-UHFFFAOYSA-N
| CAS_number = 55300-30-6
| ATC_prefix = none
| ATC_suffix =
| PubChem = 68723
| DrugBank = DB01419
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 61973
| C = 30 | H = 26 | F = 6 | N = 4 | O = 2
| molecular_weight = 588.543 g/mol
| smiles = FC(F)(F)c5ccc1c(nccc1Nc2ccccc2C(=O)OCCN4CCN(c3cc(ccc3)C(F)(F)F)CC4)c5
| bioavailability =
| metabolism = [[Hepatic]]
| elimination_half-life =
| excretion = [[Renal]]
| pregnancy_category =
| legal_status = Rx-only
| routes_of_administration = [[Mouth|Oral]]
}}
}}


'''Antrafenine''' ('''Stakane''') is a [[phenylpiperazine]] [[chemical derivative|derivative]] [[drug]] invented in 1979.<ref> Manoury PM, Dumas AP, Najer H, Branceni D, Prouteau M, Lefevre-Borg FM. Synthesis and analgesic activities of some (4-substituted phenyl-1-piperazinyl)alkyl 2-aminobenzoates and 2-aminonicotinates. Journal of Medicinal Chemistry. 1979 May;22(5):554-9. </ref> It acts as an [[analgesic]] and [[anti-inflammatory]] drug with similar efficacy to [[naproxen]],<ref> Leatham PA, Bird HA, Wright V, Seymour D, Gordon A. A double blind study of antrafenine, naproxen and placebo in osteoarthrosis. European Journal of Rheumatology and Inflammation. 1983;6(2):209-11. </ref> but is not widely used as it has largely been replaced by newer drugs.
'''Antrafenine''' ('''Stakane''') is a [[phenylpiperazine]] [[chemical derivative|derivative]] [[pharmaceutical drug|drug]] invented in 1979.<ref name="pmid458805">{{cite journal | vauthors = Manoury PM, Dumas AP, Najer H, Branceni D, Prouteau M, Lefevre-Borg FM | title = Synthesis and analgesic activities of some (4-substituted phenyl-1-piperazinyl)alkyl 2-aminobenzoates and 2-aminonicotinates | journal = Journal of Medicinal Chemistry | volume = 22 | issue = 5 | pages = 554–9 | date = May 1979 | pmid = 458805 | doi = 10.1021/jm00191a017 }}</ref> It acts as an [[analgesic]] and [[anti-inflammatory]] drug with similar efficacy to [[naproxen]],<ref name="pmid6673985">{{cite journal | vauthors = Leatham PA, Bird HA, Wright V, Seymour D, Gordon A | title = A double blind study of antrafenine, naproxen and placebo in osteoarthrosis | journal = European Journal of Rheumatology and Inflammation | volume = 6 | issue = 2 | pages = 209–11 | date = 1983 | pmid = 6673985 }}</ref> but is not widely used as it has largely been replaced by newer drugs.


==Synthesis==
[[File:Antrafenine synthesis.svg|thumb|500px|center|[https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-01-0141 Thieme] Synthesis:<ref name="pmid458805"/> Patents:<ref>Don Pierre Rene Lucien Giudicelli, et al. {{US patent|4017623}} (1977 to Synthelabo SA).</ref><ref>Don Pierre Rene Lucien Giudicelli, et al. {{US patent|3935229}} (1976 to Synthelabo SA).</ref><ref>Don Pierre Rene Lucien Giudicelli, et al. {{US patent|3953449}} (1976 to Synthelabo SA).</ref>]]

Method E: The reaction between 2-[4-[3-(trifluoromethyl)phenyl]-1-piperazinyl]ethanol [40004-29-3] ('''1''') and [[Isatoic anhydride]] [118-48-9] ('''2''') goes on to give 4-(3-(Trifluoromethyl)phenyl)piperazine-1-ethyl 2-aminobenzoate [51941-08-3] ('''3''').

Method G: Alkylation with 4-chloro-7-(trifluoromethyl)quinoline [346-55-4] ('''4''') completed the synthesis of antrafenine ('''5''').
== See also ==
== See also ==
* [[Phenylpiperazine]]
* [[Phenylpiperazine]]
*[[Trifluoromethylphenylpiperazine]]


== References ==
== References ==
{{Reflist}}
{{Reflist}}



{{Anti-inflammatory}}
{{Anti-inflammatory}}
{{Analgesics}}
{{Analgesics}}
{{Prostanoidergics}}
{{Piperazines}}
{{Piperazines}}


[[Category:Piperazines]]
[[Category:meta-Trifluoromethylphenylpiperazines]]
[[Category:Organofluorides]]
[[Category:Anthranilates]]
[[Category:Anthranilates]]
[[Category:Quinolines]]
[[Category:Quinolines]]

{{musculoskeletal-drug-stub}}