Jump to content

Cefpirome: Difference between revisions

Browse history interactively
Page 1
Page 2
← Previous edit
Content deleted Content added
VisualWikitext
CheMoBot (talk | contribs)
Bots
141,565 edits
Updating {{drugbox}} (changes to watched fields - added verified revid - updated 'ChemSpiderID_Ref', 'ChEMBL_Ref', 'ChEBI_Ref', 'StdInChI_Ref', 'StdInChIKey_Ref', 'ChEBI_Ref') per Chem/Drugbox validation (report [[Wikipedia talk:Wiki
Importing Wikidata short description: "Chemical compound"
 
(24 intermediate revisions by 18 users not shown)
Line 1: Line 1:
{{Short description|Chemical compound}}
{{Drugbox
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| Watchedfields = changed
| verifiedrevid = 443821017
| verifiedrevid = 447915116
| IUPAC_name = 1-{[(6''R'',7''R'')-7-[(2''E'')-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-2-carboxylato-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-5''H'',6''H'',7''H''-cyclopenta[''b'']pyridin-1-ium
| IUPAC_name = 1-{[(6''R'',7''R'')-7-[(2''E'')-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetamido]-2-carboxylato-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-3-yl]methyl}-5''H'',6''H'',7''H''-cyclopenta[''b'']pyridin-1-ium
| image = Cefpirome.svg
| image = Cefpirome.svg


<!--Clinical data-->
<!--Clinical data-->
| tradename =
| tradename =
| Drugs.com = {{drugs.com|international|cefpirome}}
| Drugs.com = {{drugs.com|international|cefpirome}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status =
| legal_status =
| routes_of_administration =
| routes_of_administration =


<!--Pharmacokinetic data-->
<!--Pharmacokinetic data-->
| bioavailability =
| bioavailability =
| protein_bound =
| protein_bound =
| metabolism =
| metabolism =
| elimination_half-life =
| elimination_half-life =
| excretion =
| excretion =


<!--Identifiers-->
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 84957-29-9
| CAS_number = 84957-29-9
| ATC_prefix = J01
| ATC_prefix = J01
Line 31: Line 34:
| PubChem = 6917674
| PubChem = 6917674
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| DrugBank =
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 2106076
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = S72Q2F09HY
| UNII = S72Q2F09HY
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D07649
| KEGG = D07649
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 23089536
| smiles = CON=C(c1csc(n1)N)C(=O)NC2C3N(C2=O)C(=C(CS3)C[n+]4cccc5c4CCC5)C(=O)[O-]
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H22N6O5S2/c1-33-26-15(13-10-35-22(23)24-13)18(29)25-16-19(30)28-17(21(31)32)12(9-34-20(16)28)8-27-7-3-5-11-4-2-6-14(11)27/h3,5,7,10,16,20H,2,4,6,8-9H2,1H3,(H3-,23,24,25,29,31,32)/b26-15-/t16-,20+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = DKOQGJHPHLTOJR-XECLGWKCSA-N


<!--Chemical data-->
<!--Chemical data-->
| C=22 | H=22 | N=6 | O=5 | S=2
| C=22 | H=22 | N=6 | O=5 | S=2
| molecular_weight = 514.58 g/mol
}}
}}
'''Cefpirome''' is a fourth-generation [[cephalosporin]]. Trade names include Cefrom, Keiten, Broact, Cefir. Cefpirome is considered highly active against [[Gram-negative bacteria]], including ''[[Pseudomonas aeruginosa]]'', and [[Gram-positive bacteria]].
'''Cefpirome''' is a fourth-generation [[cephalosporin]]. Trade names include Cefrom, Keiten, Broact, and Cefir. Cefpirome is considered highly active against [[Gram-negative bacteria]], including ''[[Pseudomonas aeruginosa]]'', and [[Gram-positive bacteria]].{{cn|date=January 2023}}

It is marketed under the brand name of ''' CEFROM ''' by sanofi aventis group india .
== Spectrum of bacterial susceptibility and resistance ==
⚫
{{antibiotic-stub}}
''[[Bacteroides fragilis]]'', [[enterococci]], ''[[Pseudomonas]]'' spp. and [[staphylococci]] are resistant to cefpirome sulfate, and some ''[[Haemophilus]]'' spp. and [[pneumococci]] have developed resistance to it to varying degrees.<ref>{{cite web|title=Cefpirome Sulfate spectrum of bacterial susceptibility and Resistance|url=http://www.toku-e.com/Assets/MIC/Cefpirome.pdf|access-date=10 April 2012|archive-url=https://web.archive.org/web/20160303214125/http://www.toku-e.com/Assets/MIC/Cefpirome.pdf|archive-date=3 March 2016|url-status=dead}}</ref>

==References==

<references />


{{CephalosporinAntiBiotics}}
{{CephalosporinAntiBiotics}}

[[Category:Cephalosporin antibiotics]]
[[Category:Cephalosporin antibiotics]]
[[Category:Thiazoles]]
[[Category:Thiazoles]]
[[Category:Oximes]]
[[Category:Ketoximes]]



[[fr:Cefpirome]]
⚫
{{antibiotic-stub}}
[[ru:Цефпиром]]
Retrieved from "https://en.wikipedia.org/wiki/Special:ComparePages"