Chlorcyclizine: Difference between revisions

{{drugbox

| Verifiedfields = changed

| UNII_Ref = {{fdacite|changed|FDA}}

| verifiedrevid = 414062299

| IUPAC_name = 1-[(4-chlorophenyl)(phenyl)methyl]-4-methylpiperazine

| image = Chlorcyclizine.png

| InChI = 1/C18H21ClN2/c1-20-11-13-21(14-12-20)18(15-5-3-2-4-6-15)16-7-9-17(19)10-8-16/h2-10,18H,11-14H2,1H3

| InChIKey = WFNAKBGANONZEQ-UHFFFAOYAF

| CAS_number = 82-93-9

| ATC_prefix = R06

| ATC_suffix = AE04

| PubChem = 2710

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 2609

| C = 18 | H = 21 | Cl = 1 | N = 2

| molecular_weight = 300.826 g/mol

| smiles = Clc1ccc(cc1)C(c2ccccc2)N3CCN(CC3)C

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

'''Chlorcyclizine''' ('''Di-Paralene''', '''Mantadil''', '''Pruresidine''', '''Trihistan''') is a [[first-generation antihistamine]] of the [[phenylpiperazine]] class marketed in the [[United States]] and certain other countries.<ref name="isbn3-88763-075-0">{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | pages = | isbn = 3-88763-075-0 | oclc = | doi = | url = http://books.google.com/books?id=5GpcTQD_L2oC&lpg=PA1228&dq=Chlorcyclizine&pg=PA212#v=onepage&q&f=false}}</ref><ref name="isbn0-412-46630-9">{{cite book | author = David J. Triggle | title = Dictionary of Pharmacological Agents | publisher = Chapman & Hall/CRC | location = Boca Raton | year = 1996 | pages = | isbn = 0-412-46630-9 | oclc = | doi = | url = http://books.google.com/books?id=DeX7jgInYFMC&lpg=PA417&dq=Chlorcyclizine&pg=PA417#v=onepage&q&f=false}}</ref><ref name="isbn0-7514-0499-3">{{cite book | author = Hall, Judith A.; Morton, Ian | title = Concise dictionary of pharmacological agents: properties and synonyms | publisher = Kluwer Academic | location = | year = 1999 | pages = | isbn = 0-7514-0499-3 | oclc = | doi = | url = http://books.google.com/books?id=mqaOMOtk61IC&lpg=PA72&dq=Chlorcyclizine&pg=PA72#v=onepage&q&f=false}}</ref> It is used primarily to treat [[allergy]] [[symptom]]s such as [[rhinitis]], [[urticaria]], and [[pruritus]], and may also be used as an [[antiemetic]].<ref name="isbn3-88763-075-0"/><ref name="isbn0-412-46630-9"/><ref name="isbn0-7514-0499-3"/> In addition to its [[antihistamine]] effects, chlorcyclizine also has some [[anticholinergic]], [[antiserotonergic]], and [[local anesthetic]] properties.<ref name="isbn2-84299-899-5">{{cite book | author = Dorland Staff | title = Dorland Dictionnaire Medical Bilingue Francais-anglais / Anglais-francais: + E-book a Telecharger (French Edition) | publisher = Elsevier (Educa Books) | location = | year = 2008 | pages = | isbn = 2-84299-899-5 | oclc = | doi = | url = http://books.google.com/books?id=tQNqwsnkK-QC&lpg=PA1152&dq=chlorcyclizine%20anticholinergic&lr&as_brr=3&pg=PA1152#v=onepage&q&f=false}}</ref><ref name="pmid6120505">{{cite journal | author = Rogóz Z, Skuza G, Sowińska H | title = The effect of the antihistaminic drugs on the central action of 5-hydroxytryptophan in mice | journal = Polish Journal of Pharmacology and Pharmacy | volume = 33 | issue = 4 | pages = 459–65 | year = 1981 | month = November | pmid = 6120505 | doi = | url = }}</ref>

* [[Meclozine]]

==References==

{{Antihistamines}}

{{Analgesics}}

[[Category:Organochlorides]]

[[Category:Piperazines]]

[[it:Clorciclizina]]

[[th:คลอร์ไซคลิซีน]]