DPI-221: Difference between revisions

Browse history interactively

← Previous edit

Content deleted Content added

VisualWikitext

@@ Line 1: / Line 1: @@
+{{Short description|Chemical compound}}
-{{drugbox |
+{{Drugbox
-| image = DPI-221.svg
+| verifiedrevid = 410884536
 | IUPAC_name = 4-((αS)-α-((2S,5R)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide
+| image = DPI-221 Structure.svg
+<!--Clinical data-->
+| tradename =
+| legal_status =
+<!--Identifiers-->
+| CAS_number =
 | PubChem = 9891642
+| ChemSpiderID      = 8067312
-| C = 21 | H = 38 | F = 1 | N = 3 | O = 1
-| molecular_weight  = 487.65 g/mol
+<!--Chemical data-->
-| smiles = c2ccccc2C(c(cc4)ccc4C(=O)N(CC)CC)N(CC1C)C(C)CN1Cc(c3)cccc3F
+| chemical_formula  = C<sub>31</sub>H<sub>38</sub>FN<sub>3</sub>O
-| CAS_number =
+| molecular_weight  = 487.651
-| legal_status =
+| smiles            = O=C(N(CC)CC)c1ccc(cc1)[C@@H](N3C[C@H](N(Cc2cc(F)ccc2)C[C@@H]3C)C)c4ccccc4
+| StdInChI          = 1S/C31H38FN3O/c1-5-33(6-2)31(36)28-17-15-27(16-18-28)30(26-12-8-7-9-13-26)35-21-23(3)34(20-24(35)4)22-25-11-10-14-29(32)19-25/h7-19,23-24,30H,5-6,20-22H2,1-4H3/t23-,24+,30+/m1/s1
+| StdInChIKey       = KEXJLZMJVOTFOY-QEGDFHJFSA-N
 }}
-'''DPI-221''' is a drug which is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]] which produces less [[convulsion]]s than most drugs from this family.<ref>{{cite journal | last1 = Holt | first1 = JD | last2 = Watson | first2 = MJ | last3 = Chang | first3 = JP | last4 = O'Neill | first4 = SJ | last5 = Wei | first5 = K | last6 = Pendergast | first6 = W | last7 = Gengo | first7 = PJ | last8 = Chang | first8 = KJ | title = DPI-221 4-((alpha-s)-alpha-((2s,5r)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide: a novel nonpeptide delta receptor agonist producing increased micturition interval in normal rats | journal = The Journal of pharmacology and experimental therapeutics | volume = 315 | issue = 2 | pages = 601–8 | year = 2005 | pmid = 16020629 | doi = 10.1124/jpet.105.090498 }}</ref>
+'''DPI-221''' is an [[opioid]] [[drug]] that is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]], which produces fewer [[convulsion]]s than most drugs from this family.<ref>{{cite journal | vauthors = Holt JD, Watson MJ, Chang JP, O'Neill SJ, Wei K, Pendergast W, Gengo PJ, Chang KJ | display-authors = 6 | title = DPI-221 [4-((alpha-s)-alpha-((2s,5r)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide]: a novel nonpeptide delta receptor agonist producing increased micturition interval in normal rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 2 | pages = 601–8 | date = November 2005 | pmid = 16020629 | doi = 10.1124/jpet.105.090498 | s2cid = 97486165 }}</ref>
+== References ==
+{{Reflist|2}}
+{{Opioidergics}}
-==References==
-<references/>
 [[Category:Synthetic opioids]]
-[[Category:Delta-opioid agonists]]
+[[Category:Delta-opioid receptor agonists]]
 [[Category:Benzamides]]
 [[Category:Piperazines]]
-[[Category:Organofluorides]]
+[[Category:Fluoroarenes]]