DPI-221: Difference between revisions
Appearance
Content deleted Content added
No edit summary |
Fixed spacing between stub template and category templates. |
||
(15 intermediate revisions by 15 users not shown) | |||
Line 1: | Line 1: | ||
{{Short description|Chemical compound}} |
|||
{{drugbox | |
|||
{{Drugbox |
|||
⚫ | |||
| verifiedrevid = 410884536 |
|||
| IUPAC_name = 4-((αS)-α-((2S,5R)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide |
| IUPAC_name = 4-((αS)-α-((2S,5R)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide |
||
⚫ | |||
<!--Clinical data--> |
|||
| tradename = |
|||
⚫ | |||
<!--Identifiers--> |
|||
⚫ | |||
| PubChem = 9891642 |
| PubChem = 9891642 |
||
| ChemSpiderID = 8067312 |
|||
| C = 21 | H = 38 | F = 1 | N = 3 | O = 1 |
|||
⚫ | |||
<!--Chemical data--> |
|||
| smiles = c2ccccc2C(c(cc4)ccc4C(=O)N(CC)CC)N(CC1C)C(C)CN1Cc(c3)cccc3F |
|||
| chemical_formula = C<sub>31</sub>H<sub>38</sub>FN<sub>3</sub>O |
|||
⚫ | |||
⚫ | |||
⚫ | |||
| smiles = O=C(N(CC)CC)c1ccc(cc1)[C@@H](N3C[C@H](N(Cc2cc(F)ccc2)C[C@@H]3C)C)c4ccccc4 |
|||
| StdInChI = 1S/C31H38FN3O/c1-5-33(6-2)31(36)28-17-15-27(16-18-28)30(26-12-8-7-9-13-26)35-21-23(3)34(20-24(35)4)22-25-11-10-14-29(32)19-25/h7-19,23-24,30H,5-6,20-22H2,1-4H3/t23-,24+,30+/m1/s1 |
|||
| StdInChIKey = KEXJLZMJVOTFOY-QEGDFHJFSA-N |
|||
}} |
}} |
||
'''DPI-221''' is |
'''DPI-221''' is an [[opioid]] [[drug]] that is used in scientific research. It is a highly selective [[agonist]] for the [[Delta opioid receptor|δ-opioid]] [[Receptor (biochemistry)|receptor]], which produces fewer [[convulsion]]s than most drugs from this family.<ref>{{cite journal | vauthors = Holt JD, Watson MJ, Chang JP, O'Neill SJ, Wei K, Pendergast W, Gengo PJ, Chang KJ | display-authors = 6 | title = DPI-221 [4-((alpha-s)-alpha-((2s,5r)-2,5-dimethyl-4-(3-fluorobenzyl)-1-piperazinyl)benzyl)-N,N-diethylbenzamide]: a novel nonpeptide delta receptor agonist producing increased micturition interval in normal rats | journal = The Journal of Pharmacology and Experimental Therapeutics | volume = 315 | issue = 2 | pages = 601–8 | date = November 2005 | pmid = 16020629 | doi = 10.1124/jpet.105.090498 | s2cid = 97486165 }}</ref> |
||
⚫ | |||
{{Reflist|2}} |
|||
{{Opioidergics}} |
|||
⚫ | |||
<references/> |
|||
[[Category:Synthetic opioids]] |
[[Category:Synthetic opioids]] |
||
[[Category:Delta-opioid agonists]] |
[[Category:Delta-opioid receptor agonists]] |
||
[[Category:Benzamides]] |
[[Category:Benzamides]] |
||
[[Category:Piperazines]] |
[[Category:Piperazines]] |
||
[[Category: |
[[Category:Fluoroarenes]] |
||